C26H25NO4 — CID 3969443
(7,8-dimethyl-2-oxochromen-4-yl)methyl 2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylate (PubChem CID 3969443) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 3969443 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylate |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)OCc3cc(=O)oc4c(C)c(C)ccc34)c2C)cc1 |
| InChI | InChI=1S/C26H25NO4/c1-15-6-9-21(10-7-15)27-17(3)12-23(19(27)5)26(29)30-14-20-13-24(28)31-25-18(4)16(2)8-11-22(20)25/h6-13H,14H2,1-5H3 |
| InChIKey | BGYNUGZYLJRFNK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|