C27H26FNO4 — CID 5228003
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 5228003) has the molecular formula C27H26FNO4 and a molecular weight of 447.51 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 5228003 |
| Molecular Formula | C27H26FNO4 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3cc(C)n(-c4ccc(F)cc4)c3C)c2cc1C(C)C |
| InChI | InChI=1S/C27H26FNO4/c1-15(2)22-13-24-19(12-26(30)33-25(24)10-16(22)3)14-32-27(31)23-11-17(4)29(18(23)5)21-8-6-20(28)7-9-21/h6-13,15H,14H2,1-5H3 |
| InChIKey | ZCMABEAMTJEEGS-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|