C27H27NO4 — CID 5039598
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2,5-dimethyl-1-phenylpyrrole-3-carboxylate (PubChem CID 5039598) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2,5-dimethyl-1-phenylpyrrole-3-carboxylate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2,5-dimethyl-1-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 5039598 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2,5-dimethyl-1-phenylpyrrole-3-carboxylate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3cc(C)n(-c4ccccc4)c3C)c2cc1C(C)C |
| InChI | InChI=1S/C27H27NO4/c1-16(2)22-14-24-20(13-26(29)32-25(24)11-17(22)3)15-31-27(30)23-12-18(4)28(19(23)5)21-9-7-6-8-10-21/h6-14,16H,15H2,1-5H3 |
| InChIKey | SVPMPBLJGNVVIY-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|