C30H26N2O4 — CID 4654848
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 1,3-diphenylpyrazole-4-carboxylate (PubChem CID 4654848) has the molecular formula C30H26N2O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 1,3-diphenylpyrazole-4-carboxylate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 1,3-diphenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 4654848 |
| Molecular Formula | C30H26N2O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 1,3-diphenylpyrazole-4-carboxylate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3cn(-c4ccccc4)nc3-c3ccccc3)c2cc1C(C)C |
| InChI | InChI=1S/C30H26N2O4/c1-19(2)24-16-25-22(15-28(33)36-27(25)14-20(24)3)18-35-30(34)26-17-32(23-12-8-5-9-13-23)31-29(26)21-10-6-4-7-11-21/h4-17,19H,18H2,1-3H3 |
| InChIKey | CLWSIIKOHHZQOW-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|