C30H24ClNO4 — CID 4002009
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(4-chlorophenyl)quinoline-4-carboxylate (PubChem CID 4002009) has the molecular formula C30H24ClNO4 and a molecular weight of 497.98 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(4-chlorophenyl)quinoline-4-carboxylate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(4-chlorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4002009 |
| Molecular Formula | C30H24ClNO4 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(4-chlorophenyl)quinoline-4-carboxylate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3cc(-c4ccc(Cl)cc4)nc4ccccc34)c2cc1C(C)C |
| InChI | InChI=1S/C30H24ClNO4/c1-17(2)23-14-24-20(13-29(33)36-28(24)12-18(23)3)16-35-30(34)25-15-27(19-8-10-21(31)11-9-19)32-26-7-5-4-6-22(25)26/h4-15,17H,16H2,1-3H3 |
| InChIKey | HRWZMZWRFMZGII-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|