C24H22N2O5 — CID 7995089
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(4-oxoquinazolin-3-yl)acetate (PubChem CID 7995089) has the molecular formula C24H22N2O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(4-oxoquinazolin-3-yl)acetate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(4-oxoquinazolin-3-yl)acetate |
|---|---|
| PubChem CID | 7995089 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-(4-oxoquinazolin-3-yl)acetate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)Cn3cnc4ccccc4c3=O)c2cc1C(C)C |
| InChI | InChI=1S/C24H22N2O5/c1-14(2)18-10-19-16(9-22(27)31-21(19)8-15(18)3)12-30-23(28)11-26-13-25-20-7-5-4-6-17(20)24(26)29/h4-10,13-14H,11-12H2,1-3H3 |
| InChIKey | NIWLQTXVFYABDZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 91.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|