C30H26O6 — CID 3909133
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 3909133) has the molecular formula C30H26O6 and a molecular weight of 482.53 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 3909133 |
| Molecular Formula | C30H26O6 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-(phenoxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3oc4ccccc4c3COc3ccccc3)c2cc1C(C)C |
| InChI | InChI=1S/C30H26O6/c1-18(2)23-15-24-20(14-28(31)35-27(24)13-19(23)3)16-34-30(32)29-25(17-33-21-9-5-4-6-10-21)22-11-7-8-12-26(22)36-29/h4-15,18H,16-17H2,1-3H3 |
| InChIKey | ZSDJIGKJYCSLGZ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|