C21H22O5S — CID 51174545
7-methyl-4-[(4-methylsulfonylphenoxy)methyl]-6-propan-2-ylchromen-2-one (PubChem CID 51174545) has the molecular formula C21H22O5S and a molecular weight of 386.47 g/mol. Its IUPAC name is 7-methyl-4-[(4-methylsulfonylphenoxy)methyl]-6-propan-2-ylchromen-2-one.
| Compound Name | 7-methyl-4-[(4-methylsulfonylphenoxy)methyl]-6-propan-2-ylchromen-2-one |
|---|---|
| PubChem CID | 51174545 |
| Molecular Formula | C21H22O5S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 7-methyl-4-[(4-methylsulfonylphenoxy)methyl]-6-propan-2-ylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(COc3ccc(S(C)(=O)=O)cc3)c2cc1C(C)C |
| InChI | InChI=1S/C21H22O5S/c1-13(2)18-11-19-15(10-21(22)26-20(19)9-14(18)3)12-25-16-5-7-17(8-6-16)27(4,23)24/h5-11,13H,12H2,1-4H3 |
| InChIKey | MNYZCOZQEBQSFP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|