C19H15F3O3 — CID 7467569
6,7-dimethyl-4-[[4-(trifluoromethyl)phenoxy]methyl]chromen-2-one (PubChem CID 7467569) has the molecular formula C19H15F3O3 and a molecular weight of 348.32 g/mol. Its IUPAC name is 6,7-dimethyl-4-[[4-(trifluoromethyl)phenoxy]methyl]chromen-2-one.
| Compound Name | 6,7-dimethyl-4-[[4-(trifluoromethyl)phenoxy]methyl]chromen-2-one |
|---|---|
| PubChem CID | 7467569 |
| Molecular Formula | C19H15F3O3 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 6,7-dimethyl-4-[[4-(trifluoromethyl)phenoxy]methyl]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(COc3ccc(C(F)(F)F)cc3)c2cc1C |
| InChI | InChI=1S/C19H15F3O3/c1-11-7-16-13(9-18(23)25-17(16)8-12(11)2)10-24-15-5-3-14(4-6-15)19(20,21)22/h3-9H,10H2,1-2H3 |
| InChIKey | VUPOAXJKKYLOHY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|