C18H13Cl3O3 — CID 7832785
6,7-dimethyl-4-[(2,4,5-trichlorophenoxy)methyl]chromen-2-one (PubChem CID 7832785) has the molecular formula C18H13Cl3O3 and a molecular weight of 383.66 g/mol. Its IUPAC name is 6,7-dimethyl-4-[(2,4,5-trichlorophenoxy)methyl]chromen-2-one.
| Compound Name | 6,7-dimethyl-4-[(2,4,5-trichlorophenoxy)methyl]chromen-2-one |
|---|---|
| PubChem CID | 7832785 |
| Molecular Formula | C18H13Cl3O3 |
| Molecular Weight | 383.66 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | 6,7-dimethyl-4-[(2,4,5-trichlorophenoxy)methyl]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(COc3cc(Cl)c(Cl)cc3Cl)c2cc1C |
| InChI | InChI=1S/C18H13Cl3O3/c1-9-3-12-11(5-18(22)24-16(12)4-10(9)2)8-23-17-7-14(20)13(19)6-15(17)21/h3-7H,8H2,1-2H3 |
| InChIKey | MVKKQKKLKGHZEP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.66 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|