C22H23ClO3 — CID 23969072
4-butyl-6-chloro-7-[(2,5-dimethylphenyl)methoxy]chromen-2-one (PubChem CID 23969072) has the molecular formula C22H23ClO3 and a molecular weight of 370.88 g/mol. Its IUPAC name is 4-butyl-6-chloro-7-[(2,5-dimethylphenyl)methoxy]chromen-2-one.
| Compound Name | 4-butyl-6-chloro-7-[(2,5-dimethylphenyl)methoxy]chromen-2-one |
|---|---|
| PubChem CID | 23969072 |
| Molecular Formula | C22H23ClO3 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 4-butyl-6-chloro-7-[(2,5-dimethylphenyl)methoxy]chromen-2-one |
| SMILES | CCCCc1cc(=O)oc2cc(OCc3cc(C)ccc3C)c(Cl)cc12 |
| InChI | InChI=1S/C22H23ClO3/c1-4-5-6-16-10-22(24)26-20-12-21(19(23)11-18(16)20)25-13-17-9-14(2)7-8-15(17)3/h7-12H,4-6,13H2,1-3H3 |
| InChIKey | XKARCUUAAIOIQK-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|