About 4-butyl-6-methylchromen-2-one;formonitrile
4-butyl-6-methylchromen-2-one;formonitrile (PubChem CID 6613363) has the molecular formula C15H17NO2
and a molecular weight of 243.31 g/mol. Its IUPAC name is 4-butyl-6-methylchromen-2-one;formonitrile.
Molecular Properties
| Compound Name | 4-butyl-6-methylchromen-2-one;formonitrile |
| PubChem CID | 6613363 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 4-butyl-6-methylchromen-2-one;formonitrile |
| SMILES | C#N.CCCCc1cc(=O)oc2ccc(C)cc12 |
| InChI | InChI=1S/C14H16O2.CHN/c1-3-4-5-11-9-14(15)16-13-7-6-10(2)8-12(11)13;1-2/h6-9H,3-5H2,1-2H3;1H |
| InChIKey | GQWGRASJCPUTET-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-6-methylchromen-2-one;formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-6-methylchromen-2-one;formonitrile?
The IUPAC name of 4-butyl-6-methylchromen-2-one;formonitrile (CID 6613363) is 4-butyl-6-methylchromen-2-one;formonitrile.
What is the SMILES notation for 4-butyl-6-methylchromen-2-one;formonitrile?
The canonical SMILES for 4-butyl-6-methylchromen-2-one;formonitrile is C#N.CCCCc1cc(=O)oc2ccc(C)cc12.
What is the InChIKey of 4-butyl-6-methylchromen-2-one;formonitrile?
The InChIKey is GQWGRASJCPUTET-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O2.CHN/c1-3-4-5-11-9-14(15)16-13-7-6-10(2)8-12(11)13;1-2/h6-9H,3-5H2,1-2H3;1H.
What are the key properties of 4-butyl-6-methylchromen-2-one;formonitrile?
4-butyl-6-methylchromen-2-one;formonitrile has a molecular weight of 243.31 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-6-methylchromen-2-one;formonitrile is sourced from PubChem (CID 6613363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).