C19H19O4P — CID 39378216
(6-methyl-2-oxochromen-4-yl)methyl-(2-phenylethyl)phosphinic acid (PubChem CID 39378216) has the molecular formula C19H19O4P and a molecular weight of 342.33 g/mol. Its IUPAC name is (6-methyl-2-oxochromen-4-yl)methyl-(2-phenylethyl)phosphinic acid.
| Compound Name | (6-methyl-2-oxochromen-4-yl)methyl-(2-phenylethyl)phosphinic acid |
|---|---|
| PubChem CID | 39378216 |
| Molecular Formula | C19H19O4P |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (6-methyl-2-oxochromen-4-yl)methyl-(2-phenylethyl)phosphinic acid |
| SMILES | Cc1ccc2oc(=O)cc(CP(=O)(O)CCc3ccccc3)c2c1 |
| InChI | InChI=1S/C19H19O4P/c1-14-7-8-18-17(11-14)16(12-19(20)23-18)13-24(21,22)10-9-15-5-3-2-4-6-15/h2-8,11-12H,9-10,13H2,1H3,(H,21,22) |
| InChIKey | FXVQRJJZVLCXKH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|