C19H16N2O4 — CID 135951834
N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-(6-methyl-2-oxochromen-4-yl)acetamide (PubChem CID 135951834) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-(6-methyl-2-oxochromen-4-yl)acetamide.
| Compound Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-(6-methyl-2-oxochromen-4-yl)acetamide |
|---|---|
| PubChem CID | 135951834 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-(6-methyl-2-oxochromen-4-yl)acetamide |
| SMILES | Cc1ccc2oc(=O)cc(CC(=O)N/N=C/c3ccccc3O)c2c1 |
| InChI | InChI=1S/C19H16N2O4/c1-12-6-7-17-15(8-12)14(10-19(24)25-17)9-18(23)21-20-11-13-4-2-3-5-16(13)22/h2-8,10-11,22H,9H2,1H3,(H,21,23)/b20-11+ |
| InChIKey | CCVPPKLLPWTHBE-RGVLZGJSSA-N |
| XLogP | 2.50 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|