C21H18NO5- — CID 156619905
(2S)-2-[[2-(6-methyl-2-oxochromen-4-yl)acetyl]amino]-3-phenylpropanoate (PubChem CID 156619905) has the molecular formula C21H18NO5- and a molecular weight of 364.38 g/mol. Its IUPAC name is (2S)-2-[[2-(6-methyl-2-oxochromen-4-yl)acetyl]amino]-3-phenylpropanoate.
| Compound Name | (2S)-2-[[2-(6-methyl-2-oxochromen-4-yl)acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 156619905 |
| Molecular Formula | C21H18NO5- |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (2S)-2-[[2-(6-methyl-2-oxochromen-4-yl)acetyl]amino]-3-phenylpropanoate |
| SMILES | Cc1ccc2oc(=O)cc(CC(=O)N[C@@H](Cc3ccccc3)C(=O)[O-])c2c1 |
| InChI | InChI=1S/C21H19NO5/c1-13-7-8-18-16(9-13)15(12-20(24)27-18)11-19(23)22-17(21(25)26)10-14-5-3-2-4-6-14/h2-9,12,17H,10-11H2,1H3,(H,22,23)(H,25,26)/p-1/t17-/m0/s1 |
| InChIKey | OZONLORFIXMRSD-KRWDZBQOSA-M |
| XLogP | 1.12 |
| TPSA | 99.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|