C15H17NO3 — CID 40805355
2-(7-methyl-2-oxochromen-4-yl)-N-propan-2-ylacetamide (PubChem CID 40805355) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-(7-methyl-2-oxochromen-4-yl)-N-propan-2-ylacetamide.
| Compound Name | 2-(7-methyl-2-oxochromen-4-yl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 40805355 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-(7-methyl-2-oxochromen-4-yl)-N-propan-2-ylacetamide |
| SMILES | Cc1ccc2c(CC(=O)NC(C)C)cc(=O)oc2c1 |
| InChI | InChI=1S/C15H17NO3/c1-9(2)16-14(17)7-11-8-15(18)19-13-6-10(3)4-5-12(11)13/h4-6,8-9H,7H2,1-3H3,(H,16,17) |
| InChIKey | DXMTUWJMTHEBHX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|