C20H19NO4 — CID 41180282
N-(2-ethoxyphenyl)-2-(7-methyl-2-oxochromen-4-yl)acetamide (PubChem CID 41180282) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-2-(7-methyl-2-oxochromen-4-yl)acetamide.
| Compound Name | N-(2-ethoxyphenyl)-2-(7-methyl-2-oxochromen-4-yl)acetamide |
|---|---|
| PubChem CID | 41180282 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-(2-ethoxyphenyl)-2-(7-methyl-2-oxochromen-4-yl)acetamide |
| SMILES | CCOc1ccccc1NC(=O)Cc1cc(=O)oc2cc(C)ccc12 |
| InChI | InChI=1S/C20H19NO4/c1-3-24-17-7-5-4-6-16(17)21-19(22)11-14-12-20(23)25-18-10-13(2)8-9-15(14)18/h4-10,12H,3,11H2,1-2H3,(H,21,22) |
| InChIKey | JAJILHQIRAGFDT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|