C20H19NO5S — CID 171909711
N-(2-methyl-5-methylsulfonylphenyl)-2-(7-methyl-2-oxochromen-4-yl)acetamide (PubChem CID 171909711) has the molecular formula C20H19NO5S and a molecular weight of 385.44 g/mol. Its IUPAC name is N-(2-methyl-5-methylsulfonylphenyl)-2-(7-methyl-2-oxochromen-4-yl)acetamide.
| Compound Name | N-(2-methyl-5-methylsulfonylphenyl)-2-(7-methyl-2-oxochromen-4-yl)acetamide |
|---|---|
| PubChem CID | 171909711 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-(2-methyl-5-methylsulfonylphenyl)-2-(7-methyl-2-oxochromen-4-yl)acetamide |
| SMILES | Cc1ccc2c(CC(=O)Nc3cc(S(C)(=O)=O)ccc3C)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H19NO5S/c1-12-4-7-16-14(10-20(23)26-18(16)8-12)9-19(22)21-17-11-15(27(3,24)25)6-5-13(17)2/h4-8,10-11H,9H2,1-3H3,(H,21,22) |
| InChIKey | CBKHEGGBWMJPKL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|