C12H9O4- — CID 4257034
2-(7-methyl-2-oxochromen-4-yl)acetate (PubChem CID 4257034) has the molecular formula C12H9O4- and a molecular weight of 217.20 g/mol. Its IUPAC name is 2-(7-methyl-2-oxochromen-4-yl)acetate.
| Compound Name | 2-(7-methyl-2-oxochromen-4-yl)acetate |
|---|---|
| PubChem CID | 4257034 |
| Molecular Formula | C12H9O4- |
| Molecular Weight | 217.20 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 2-(7-methyl-2-oxochromen-4-yl)acetate |
| SMILES | Cc1ccc2c(CC(=O)[O-])cc(=O)oc2c1 |
| InChI | InChI=1S/C12H10O4/c1-7-2-3-9-8(5-11(13)14)6-12(15)16-10(9)4-7/h2-4,6H,5H2,1H3,(H,13,14)/p-1 |
| InChIKey | VDQLZKYCWITDPF-UHFFFAOYSA-M |
| XLogP | 0.39 |
| TPSA | 70.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.20 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|