C23H24O4 — CID 7235435
(7-methyl-2-oxochromen-4-yl)methyl 2,3,4,5,6-pentamethylbenzoate (PubChem CID 7235435) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is (7-methyl-2-oxochromen-4-yl)methyl 2,3,4,5,6-pentamethylbenzoate.
| Compound Name | (7-methyl-2-oxochromen-4-yl)methyl 2,3,4,5,6-pentamethylbenzoate |
|---|---|
| PubChem CID | 7235435 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (7-methyl-2-oxochromen-4-yl)methyl 2,3,4,5,6-pentamethylbenzoate |
| SMILES | Cc1ccc2c(COC(=O)c3c(C)c(C)c(C)c(C)c3C)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H24O4/c1-12-7-8-19-18(10-21(24)27-20(19)9-12)11-26-23(25)22-16(5)14(3)13(2)15(4)17(22)6/h7-10H,11H2,1-6H3 |
| InChIKey | MHICGJSLXYCZFG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|