C20H17NO5 — CID 2582002
(7-methyl-2-oxochromen-4-yl)methyl 3-acetamidobenzoate (PubChem CID 2582002) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is (7-methyl-2-oxochromen-4-yl)methyl 3-acetamidobenzoate.
| Compound Name | (7-methyl-2-oxochromen-4-yl)methyl 3-acetamidobenzoate |
|---|---|
| PubChem CID | 2582002 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (7-methyl-2-oxochromen-4-yl)methyl 3-acetamidobenzoate |
| SMILES | CC(=O)Nc1cccc(C(=O)OCc2cc(=O)oc3cc(C)ccc23)c1 |
| InChI | InChI=1S/C20H17NO5/c1-12-6-7-17-15(10-19(23)26-18(17)8-12)11-25-20(24)14-4-3-5-16(9-14)21-13(2)22/h3-10H,11H2,1-2H3,(H,21,22) |
| InChIKey | YUAIMDXDCLYQRB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|