C19H13F2NO5 — CID 46816359
(7-acetamido-2-oxochromen-4-yl)methyl 3,4-difluorobenzoate (PubChem CID 46816359) has the molecular formula C19H13F2NO5 and a molecular weight of 373.31 g/mol. Its IUPAC name is (7-acetamido-2-oxochromen-4-yl)methyl 3,4-difluorobenzoate.
| Compound Name | (7-acetamido-2-oxochromen-4-yl)methyl 3,4-difluorobenzoate |
|---|---|
| PubChem CID | 46816359 |
| Molecular Formula | C19H13F2NO5 |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | (7-acetamido-2-oxochromen-4-yl)methyl 3,4-difluorobenzoate |
| SMILES | CC(=O)Nc1ccc2c(COC(=O)c3ccc(F)c(F)c3)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H13F2NO5/c1-10(23)22-13-3-4-14-12(7-18(24)27-17(14)8-13)9-26-19(25)11-2-5-15(20)16(21)6-11/h2-8H,9H2,1H3,(H,22,23) |
| InChIKey | DEPPPMPVQPHZRX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|