C21H16Cl2N2O6 — CID 46789290
(7-acetamido-2-oxochromen-4-yl)methyl 2-[(2,4-dichlorobenzoyl)amino]acetate (PubChem CID 46789290) has the molecular formula C21H16Cl2N2O6 and a molecular weight of 463.27 g/mol. Its IUPAC name is (7-acetamido-2-oxochromen-4-yl)methyl 2-[(2,4-dichlorobenzoyl)amino]acetate.
| Compound Name | (7-acetamido-2-oxochromen-4-yl)methyl 2-[(2,4-dichlorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 46789290 |
| Molecular Formula | C21H16Cl2N2O6 |
| Molecular Weight | 463.27 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | (7-acetamido-2-oxochromen-4-yl)methyl 2-[(2,4-dichlorobenzoyl)amino]acetate |
| SMILES | CC(=O)Nc1ccc2c(COC(=O)CNC(=O)c3ccc(Cl)cc3Cl)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H16Cl2N2O6/c1-11(26)25-14-3-5-15-12(6-19(27)31-18(15)8-14)10-30-20(28)9-24-21(29)16-4-2-13(22)7-17(16)23/h2-8H,9-10H2,1H3,(H,24,29)(H,25,26) |
| InChIKey | YWRWLQKHMPUDBW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|