C18H16Cl2N2O4 — CID 1218600
(2,4-dichlorophenyl)methyl 2-[(4-acetamidobenzoyl)amino]acetate (PubChem CID 1218600) has the molecular formula C18H16Cl2N2O4 and a molecular weight of 395.24 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl 2-[(4-acetamidobenzoyl)amino]acetate.
| Compound Name | (2,4-dichlorophenyl)methyl 2-[(4-acetamidobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 1218600 |
| Molecular Formula | C18H16Cl2N2O4 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | (2,4-dichlorophenyl)methyl 2-[(4-acetamidobenzoyl)amino]acetate |
| SMILES | CC(=O)Nc1ccc(C(=O)NCC(=O)OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H16Cl2N2O4/c1-11(23)22-15-6-3-12(4-7-15)18(25)21-9-17(24)26-10-13-2-5-14(19)8-16(13)20/h2-8H,9-10H2,1H3,(H,21,25)(H,22,23) |
| InChIKey | XPHZGKPPTVZCDB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |