C17H14Cl2N2O4 — CID 46828283
methyl 2-[[4-[(2,5-dichlorobenzoyl)amino]benzoyl]amino]acetate (PubChem CID 46828283) has the molecular formula C17H14Cl2N2O4 and a molecular weight of 381.22 g/mol. Its IUPAC name is methyl 2-[[4-[(2,5-dichlorobenzoyl)amino]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[4-[(2,5-dichlorobenzoyl)amino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 46828283 |
| Molecular Formula | C17H14Cl2N2O4 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | methyl 2-[[4-[(2,5-dichlorobenzoyl)amino]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(NC(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H14Cl2N2O4/c1-25-15(22)9-20-16(23)10-2-5-12(6-3-10)21-17(24)13-8-11(18)4-7-14(13)19/h2-8H,9H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | ZKBDXRDGEUDGDO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |