C18H17IN2O4 — CID 38930563
methyl 2-[[4-[(2-iodo-3-methylbenzoyl)amino]benzoyl]amino]acetate (PubChem CID 38930563) has the molecular formula C18H17IN2O4 and a molecular weight of 452.25 g/mol. Its IUPAC name is methyl 2-[[4-[(2-iodo-3-methylbenzoyl)amino]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[4-[(2-iodo-3-methylbenzoyl)amino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 38930563 |
| Molecular Formula | C18H17IN2O4 |
| Molecular Weight | 452.25 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | methyl 2-[[4-[(2-iodo-3-methylbenzoyl)amino]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(NC(=O)c2cccc(C)c2I)cc1 |
| InChI | InChI=1S/C18H17IN2O4/c1-11-4-3-5-14(16(11)19)18(24)21-13-8-6-12(7-9-13)17(23)20-10-15(22)25-2/h3-9H,10H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | CINRQFDKGALWOS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|