C20H20ClNO5 — CID 7878744
(5-acetyl-2-ethoxyphenyl)methyl 2-[(4-chlorobenzoyl)amino]acetate (PubChem CID 7878744) has the molecular formula C20H20ClNO5 and a molecular weight of 389.84 g/mol. Its IUPAC name is (5-acetyl-2-ethoxyphenyl)methyl 2-[(4-chlorobenzoyl)amino]acetate.
| Compound Name | (5-acetyl-2-ethoxyphenyl)methyl 2-[(4-chlorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7878744 |
| Molecular Formula | C20H20ClNO5 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | (5-acetyl-2-ethoxyphenyl)methyl 2-[(4-chlorobenzoyl)amino]acetate |
| SMILES | CCOc1ccc(C(C)=O)cc1COC(=O)CNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20ClNO5/c1-3-26-18-9-6-15(13(2)23)10-16(18)12-27-19(24)11-22-20(25)14-4-7-17(21)8-5-14/h4-10H,3,11-12H2,1-2H3,(H,22,25) |
| InChIKey | FMNRJMZJULGUKI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |