C24H31NO5 — CID 3358991
(5-acetyl-2-ethoxyphenyl)methyl 2-(adamantane-1-carbonylamino)acetate (PubChem CID 3358991) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is (5-acetyl-2-ethoxyphenyl)methyl 2-(adamantane-1-carbonylamino)acetate.
| Compound Name | (5-acetyl-2-ethoxyphenyl)methyl 2-(adamantane-1-carbonylamino)acetate |
|---|---|
| PubChem CID | 3358991 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | (5-acetyl-2-ethoxyphenyl)methyl 2-(adamantane-1-carbonylamino)acetate |
| SMILES | CCOc1ccc(C(C)=O)cc1COC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H31NO5/c1-3-29-21-5-4-19(15(2)26)9-20(21)14-30-22(27)13-25-23(28)24-10-16-6-17(11-24)8-18(7-16)12-24/h4-5,9,16-18H,3,6-8,10-14H2,1-2H3,(H,25,28) |
| InChIKey | BAYNIMBUCHFOKZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |