C23H31NO4 — CID 7755551
(2-ethoxyphenyl)methyl 2-[[2-(1-adamantyl)acetyl]amino]acetate (PubChem CID 7755551) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is (2-ethoxyphenyl)methyl 2-[[2-(1-adamantyl)acetyl]amino]acetate.
| Compound Name | (2-ethoxyphenyl)methyl 2-[[2-(1-adamantyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 7755551 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | (2-ethoxyphenyl)methyl 2-[[2-(1-adamantyl)acetyl]amino]acetate |
| SMILES | CCOc1ccccc1COC(=O)CNC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H31NO4/c1-2-27-20-6-4-3-5-19(20)15-28-22(26)14-24-21(25)13-23-10-16-7-17(11-23)9-18(8-16)12-23/h3-6,16-18H,2,7-15H2,1H3,(H,24,25) |
| InChIKey | XWWOAQMSZRENBQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |