C22H36N2O4 — CID 7360351
[2-[di(propan-2-yl)amino]-2-oxoethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate (PubChem CID 7360351) has the molecular formula C22H36N2O4 and a molecular weight of 392.54 g/mol. Its IUPAC name is [2-[di(propan-2-yl)amino]-2-oxoethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate.
| Compound Name | [2-[di(propan-2-yl)amino]-2-oxoethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 7360351 |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | [2-[di(propan-2-yl)amino]-2-oxoethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate |
| SMILES | CC(C)N(C(=O)COC(=O)CNC(=O)CC12CC3CC(CC(C3)C1)C2)C(C)C |
| InChI | InChI=1S/C22H36N2O4/c1-14(2)24(15(3)4)20(26)13-28-21(27)12-23-19(25)11-22-8-16-5-17(9-22)7-18(6-16)10-22/h14-18H,5-13H2,1-4H3,(H,23,25) |
| InChIKey | FEDIRDLLSSTGON-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |