C16H26N2O2 — CID 51163037
2-(1-adamantyl)-N-[2-(ethylamino)-2-oxoethyl]acetamide (PubChem CID 51163037) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[2-(ethylamino)-2-oxoethyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[2-(ethylamino)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 51163037 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 2-(1-adamantyl)-N-[2-(ethylamino)-2-oxoethyl]acetamide |
| SMILES | CCNC(=O)CNC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H26N2O2/c1-2-17-15(20)10-18-14(19)9-16-6-11-3-12(7-16)5-13(4-11)8-16/h11-13H,2-10H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | VRUYPHYCIVIJEH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |