C23H31N3O3 — CID 38404079
2-[4-[[2-[[2-(1-adamantyl)acetyl]amino]acetyl]amino]phenyl]-N-methylacetamide (PubChem CID 38404079) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-[4-[[2-[[2-(1-adamantyl)acetyl]amino]acetyl]amino]phenyl]-N-methylacetamide.
| Compound Name | 2-[4-[[2-[[2-(1-adamantyl)acetyl]amino]acetyl]amino]phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 38404079 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 2-[4-[[2-[[2-(1-adamantyl)acetyl]amino]acetyl]amino]phenyl]-N-methylacetamide |
| SMILES | CNC(=O)Cc1ccc(NC(=O)CNC(=O)CC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H31N3O3/c1-24-20(27)9-15-2-4-19(5-3-15)26-22(29)14-25-21(28)13-23-10-16-6-17(11-23)8-18(7-16)12-23/h2-5,16-18H,6-14H2,1H3,(H,24,27)(H,25,28)(H,26,29) |
| InChIKey | GQPUBAUICREXPS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |