C21H25F3N2O2 — CID 108933649
N-[[4-[[2-(1-adamantyl)acetyl]amino]phenyl]methyl]-2,2,2-trifluoroacetamide (PubChem CID 108933649) has the molecular formula C21H25F3N2O2 and a molecular weight of 394.44 g/mol. Its IUPAC name is N-[[4-[[2-(1-adamantyl)acetyl]amino]phenyl]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[4-[[2-(1-adamantyl)acetyl]amino]phenyl]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 108933649 |
| Molecular Formula | C21H25F3N2O2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-[[4-[[2-(1-adamantyl)acetyl]amino]phenyl]methyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)Nc1ccc(CNC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H25F3N2O2/c22-21(23,24)19(28)25-12-13-1-3-17(4-2-13)26-18(27)11-20-8-14-5-15(9-20)7-16(6-14)10-20/h1-4,14-16H,5-12H2,(H,25,28)(H,26,27) |
| InChIKey | LCYURQMWSAPBCH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |