C22H29FN4O3 — CID 24664912
1-[2-[2-[2-(1-adamantyl)acetyl]hydrazinyl]-2-oxoethyl]-3-[(4-fluorophenyl)methyl]urea (PubChem CID 24664912) has the molecular formula C22H29FN4O3 and a molecular weight of 416.50 g/mol. Its IUPAC name is 1-[2-[2-[2-(1-adamantyl)acetyl]hydrazinyl]-2-oxoethyl]-3-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-[2-[2-[2-(1-adamantyl)acetyl]hydrazinyl]-2-oxoethyl]-3-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 24664912 |
| Molecular Formula | C22H29FN4O3 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 1-[2-[2-[2-(1-adamantyl)acetyl]hydrazinyl]-2-oxoethyl]-3-[(4-fluorophenyl)methyl]urea |
| SMILES | O=C(CNC(=O)NCc1ccc(F)cc1)NNC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H29FN4O3/c23-18-3-1-14(2-4-18)12-24-21(30)25-13-20(29)27-26-19(28)11-22-8-15-5-16(9-22)7-17(6-15)10-22/h1-4,15-17H,5-13H2,(H,26,28)(H,27,29)(H2,24,25,30) |
| InChIKey | UJJBBUYVLKFTPP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|