C21H27FN2O4S — CID 9475003
N'-[2-(1-adamantyl)acetyl]-3-(4-fluorophenyl)sulfonylpropanehydrazide (PubChem CID 9475003) has the molecular formula C21H27FN2O4S and a molecular weight of 422.52 g/mol. Its IUPAC name is N'-[2-(1-adamantyl)acetyl]-3-(4-fluorophenyl)sulfonylpropanehydrazide.
| Compound Name | N'-[2-(1-adamantyl)acetyl]-3-(4-fluorophenyl)sulfonylpropanehydrazide |
|---|---|
| PubChem CID | 9475003 |
| Molecular Formula | C21H27FN2O4S |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N'-[2-(1-adamantyl)acetyl]-3-(4-fluorophenyl)sulfonylpropanehydrazide |
| SMILES | O=C(CCS(=O)(=O)c1ccc(F)cc1)NNC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H27FN2O4S/c22-17-1-3-18(4-2-17)29(27,28)6-5-19(25)23-24-20(26)13-21-10-14-7-15(11-21)9-16(8-14)12-21/h1-4,14-16H,5-13H2,(H,23,25)(H,24,26) |
| InChIKey | CKORIWQEPLDUAX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|