C21H26FNO3S — CID 90593047
2-(1-adamantyl)-1-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]ethanone (PubChem CID 90593047) has the molecular formula C21H26FNO3S and a molecular weight of 391.51 g/mol. Its IUPAC name is 2-(1-adamantyl)-1-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]ethanone.
| Compound Name | 2-(1-adamantyl)-1-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 90593047 |
| Molecular Formula | C21H26FNO3S |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-(1-adamantyl)-1-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]ethanone |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)N1CC(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H26FNO3S/c22-17-1-3-18(4-2-17)27(25,26)19-12-23(13-19)20(24)11-21-8-14-5-15(9-21)7-16(6-14)10-21/h1-4,14-16,19H,5-13H2 |
| InChIKey | OYNMXCBZKLJVJI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |