C26H22FNO3S — CID 90592993
3-anthracen-9-yl-1-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]propan-1-one (PubChem CID 90592993) has the molecular formula C26H22FNO3S and a molecular weight of 447.53 g/mol. Its IUPAC name is 3-anthracen-9-yl-1-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]propan-1-one.
| Compound Name | 3-anthracen-9-yl-1-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 90592993 |
| Molecular Formula | C26H22FNO3S |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 3-anthracen-9-yl-1-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]propan-1-one |
| SMILES | O=C(CCc1c2ccccc2cc2ccccc12)N1CC(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C26H22FNO3S/c27-20-9-11-21(12-10-20)32(30,31)22-16-28(17-22)26(29)14-13-25-23-7-3-1-5-18(23)15-19-6-2-4-8-24(19)25/h1-12,15,22H,13-14,16-17H2 |
| InChIKey | FNTBEKPJZNKQSE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|