C19H17FN2O3S — CID 71809253
1-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]-2-(1H-indol-3-yl)ethanone (PubChem CID 71809253) has the molecular formula C19H17FN2O3S and a molecular weight of 372.42 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]-2-(1H-indol-3-yl)ethanone.
| Compound Name | 1-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]-2-(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 71809253 |
| Molecular Formula | C19H17FN2O3S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 1-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]-2-(1H-indol-3-yl)ethanone |
| SMILES | O=C(Cc1c[nH]c2ccccc12)N1CC(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H17FN2O3S/c20-14-5-7-15(8-6-14)26(24,25)16-11-22(12-16)19(23)9-13-10-21-18-4-2-1-3-17(13)18/h1-8,10,16,21H,9,11-12H2 |
| InChIKey | ZNJSILKICQWIMD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |