C22H24N4O4S — CID 56511461
4-[2-[4-[2-(1H-indol-3-yl)acetyl]piperazin-1-yl]-2-oxoethyl]benzenesulfonamide (PubChem CID 56511461) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is 4-[2-[4-[2-(1H-indol-3-yl)acetyl]piperazin-1-yl]-2-oxoethyl]benzenesulfonamide.
| Compound Name | 4-[2-[4-[2-(1H-indol-3-yl)acetyl]piperazin-1-yl]-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 56511461 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 4-[2-[4-[2-(1H-indol-3-yl)acetyl]piperazin-1-yl]-2-oxoethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CC(=O)N2CCN(C(=O)Cc3c[nH]c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C22H24N4O4S/c23-31(29,30)18-7-5-16(6-8-18)13-21(27)25-9-11-26(12-10-25)22(28)14-17-15-24-20-4-2-1-3-19(17)20/h1-8,15,24H,9-14H2,(H2,23,29,30) |
| InChIKey | SYECZCFTCZBGBW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |