C19H20N4O5S — CID 46455552
5-[4-[2-(1H-indol-3-yl)acetyl]piperazin-1-yl]sulfonylfuran-2-carboxamide (PubChem CID 46455552) has the molecular formula C19H20N4O5S and a molecular weight of 416.46 g/mol. Its IUPAC name is 5-[4-[2-(1H-indol-3-yl)acetyl]piperazin-1-yl]sulfonylfuran-2-carboxamide.
| Compound Name | 5-[4-[2-(1H-indol-3-yl)acetyl]piperazin-1-yl]sulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 46455552 |
| Molecular Formula | C19H20N4O5S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 5-[4-[2-(1H-indol-3-yl)acetyl]piperazin-1-yl]sulfonylfuran-2-carboxamide |
| SMILES | NC(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)Cc3c[nH]c4ccccc34)CC2)o1 |
| InChI | InChI=1S/C19H20N4O5S/c20-19(25)16-5-6-18(28-16)29(26,27)23-9-7-22(8-10-23)17(24)11-13-12-21-15-4-2-1-3-14(13)15/h1-6,12,21H,7-11H2,(H2,20,25) |
| InChIKey | CBOSTXUDVUMFQP-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 129.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |