C16H25N5O5S — CID 120981052
5-[4-(3-oxo-3-piperazin-1-ylpropyl)piperazin-1-yl]sulfonylfuran-2-carboxamide (PubChem CID 120981052) has the molecular formula C16H25N5O5S and a molecular weight of 399.47 g/mol. Its IUPAC name is 5-[4-(3-oxo-3-piperazin-1-ylpropyl)piperazin-1-yl]sulfonylfuran-2-carboxamide.
| Compound Name | 5-[4-(3-oxo-3-piperazin-1-ylpropyl)piperazin-1-yl]sulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 120981052 |
| Molecular Formula | C16H25N5O5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 5-[4-(3-oxo-3-piperazin-1-ylpropyl)piperazin-1-yl]sulfonylfuran-2-carboxamide |
| SMILES | NC(=O)c1ccc(S(=O)(=O)N2CCN(CCC(=O)N3CCNCC3)CC2)o1 |
| InChI | InChI=1S/C16H25N5O5S/c17-16(23)13-1-2-15(26-13)27(24,25)21-11-9-19(10-12-21)6-3-14(22)20-7-4-18-5-8-20/h1-2,18H,3-12H2,(H2,17,23) |
| InChIKey | MDAKQIOGONPACT-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 129.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |