C16H18N4O5S — CID 119733816
5-[4-(4-aminobenzoyl)piperazin-1-yl]sulfonylfuran-2-carboxamide (PubChem CID 119733816) has the molecular formula C16H18N4O5S and a molecular weight of 378.41 g/mol. Its IUPAC name is 5-[4-(4-aminobenzoyl)piperazin-1-yl]sulfonylfuran-2-carboxamide.
| Compound Name | 5-[4-(4-aminobenzoyl)piperazin-1-yl]sulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 119733816 |
| Molecular Formula | C16H18N4O5S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 5-[4-(4-aminobenzoyl)piperazin-1-yl]sulfonylfuran-2-carboxamide |
| SMILES | NC(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(N)cc3)CC2)o1 |
| InChI | InChI=1S/C16H18N4O5S/c17-12-3-1-11(2-4-12)16(22)19-7-9-20(10-8-19)26(23,24)14-6-5-13(25-14)15(18)21/h1-6H,7-10,17H2,(H2,18,21) |
| InChIKey | ACGZVSFONUHIEB-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 139.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|