C15H22N4O5S — CID 119295058
5-[4-(piperidine-2-carbonyl)piperazin-1-yl]sulfonylfuran-2-carboxamide (PubChem CID 119295058) has the molecular formula C15H22N4O5S and a molecular weight of 370.43 g/mol. Its IUPAC name is 5-[4-(piperidine-2-carbonyl)piperazin-1-yl]sulfonylfuran-2-carboxamide.
| Compound Name | 5-[4-(piperidine-2-carbonyl)piperazin-1-yl]sulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 119295058 |
| Molecular Formula | C15H22N4O5S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 5-[4-(piperidine-2-carbonyl)piperazin-1-yl]sulfonylfuran-2-carboxamide |
| SMILES | NC(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)C3CCCCN3)CC2)o1 |
| InChI | InChI=1S/C15H22N4O5S/c16-14(20)12-4-5-13(24-12)25(22,23)19-9-7-18(8-10-19)15(21)11-3-1-2-6-17-11/h4-5,11,17H,1-3,6-10H2,(H2,16,20) |
| InChIKey | GRAQJMFJBIJOCV-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |