C22H29N3O7S — CID 55691700
5-[4-[3-methoxy-4-(3-methylbutoxy)benzoyl]piperazin-1-yl]sulfonylfuran-2-carboxamide (PubChem CID 55691700) has the molecular formula C22H29N3O7S and a molecular weight of 479.56 g/mol. Its IUPAC name is 5-[4-[3-methoxy-4-(3-methylbutoxy)benzoyl]piperazin-1-yl]sulfonylfuran-2-carboxamide.
| Compound Name | 5-[4-[3-methoxy-4-(3-methylbutoxy)benzoyl]piperazin-1-yl]sulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 55691700 |
| Molecular Formula | C22H29N3O7S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 5-[4-[3-methoxy-4-(3-methylbutoxy)benzoyl]piperazin-1-yl]sulfonylfuran-2-carboxamide |
| SMILES | COc1cc(C(=O)N2CCN(S(=O)(=O)c3ccc(C(N)=O)o3)CC2)ccc1OCCC(C)C |
| InChI | InChI=1S/C22H29N3O7S/c1-15(2)8-13-31-17-5-4-16(14-19(17)30-3)22(27)24-9-11-25(12-10-24)33(28,29)20-7-6-18(32-20)21(23)26/h4-7,14-15H,8-13H2,1-3H3,(H2,23,26) |
| InChIKey | QYYQDYXDMBLZGH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |