C23H23FN2O5S — CID 90593040
2-[6-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]-6-oxohexyl]isoindole-1,3-dione (PubChem CID 90593040) has the molecular formula C23H23FN2O5S and a molecular weight of 458.51 g/mol. Its IUPAC name is 2-[6-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]-6-oxohexyl]isoindole-1,3-dione.
| Compound Name | 2-[6-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]-6-oxohexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 90593040 |
| Molecular Formula | C23H23FN2O5S |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 2-[6-[3-(4-fluorophenyl)sulfonylazetidin-1-yl]-6-oxohexyl]isoindole-1,3-dione |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2C1=O)N1CC(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C23H23FN2O5S/c24-16-9-11-17(12-10-16)32(30,31)18-14-25(15-18)21(27)8-2-1-5-13-26-22(28)19-6-3-4-7-20(19)23(26)29/h3-4,6-7,9-12,18H,1-2,5,8,13-15H2 |
| InChIKey | SNVVZBAKOPHZOK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|