C24H34N2O4 — CID 108754184
2-[11-(3-methoxypyrrolidin-1-yl)-11-oxoundecyl]isoindole-1,3-dione (PubChem CID 108754184) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-[11-(3-methoxypyrrolidin-1-yl)-11-oxoundecyl]isoindole-1,3-dione.
| Compound Name | 2-[11-(3-methoxypyrrolidin-1-yl)-11-oxoundecyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108754184 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 2-[11-(3-methoxypyrrolidin-1-yl)-11-oxoundecyl]isoindole-1,3-dione |
| SMILES | COC1CCN(C(=O)CCCCCCCCCCN2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C24H34N2O4/c1-30-19-15-17-25(18-19)22(27)14-8-6-4-2-3-5-7-11-16-26-23(28)20-12-9-10-13-21(20)24(26)29/h9-10,12-13,19H,2-8,11,14-18H2,1H3 |
| InChIKey | KFKOTAQWFMYCIO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|