C20H24N2O6 — CID 146254122
methyl (2S)-1-[6-(1,3-dioxoisoindol-2-yl)hexanoyl]-5-hydroxypyrrolidine-2-carboxylate (PubChem CID 146254122) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is methyl (2S)-1-[6-(1,3-dioxoisoindol-2-yl)hexanoyl]-5-hydroxypyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[6-(1,3-dioxoisoindol-2-yl)hexanoyl]-5-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 146254122 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | methyl (2S)-1-[6-(1,3-dioxoisoindol-2-yl)hexanoyl]-5-hydroxypyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCC(O)N1C(=O)CCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H24N2O6/c1-28-20(27)15-10-11-17(24)22(15)16(23)9-3-2-6-12-21-18(25)13-7-4-5-8-14(13)19(21)26/h4-5,7-8,15,17,24H,2-3,6,9-12H2,1H3/t15-,17?/m0/s1 |
| InChIKey | HMVQSIOQXFCMNS-MYJWUSKBSA-N |
| XLogP | 1.33 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|