C17H19N3O5 — CID 156850093
methyl 1-[3-(1,3-dioxoisoindol-2-yl)propanoyl]piperazine-2-carboxylate (PubChem CID 156850093) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is methyl 1-[3-(1,3-dioxoisoindol-2-yl)propanoyl]piperazine-2-carboxylate.
| Compound Name | methyl 1-[3-(1,3-dioxoisoindol-2-yl)propanoyl]piperazine-2-carboxylate |
|---|---|
| PubChem CID | 156850093 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | methyl 1-[3-(1,3-dioxoisoindol-2-yl)propanoyl]piperazine-2-carboxylate |
| SMILES | COC(=O)C1CNCCN1C(=O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H19N3O5/c1-25-17(24)13-10-18-7-9-19(13)14(21)6-8-20-15(22)11-4-2-3-5-12(11)16(20)23/h2-5,13,18H,6-10H2,1H3 |
| InChIKey | DEDDHFJGMBWVAJ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|