C14H18N2O4 — CID 14751355
1-O-benzyl 2-O-methyl piperazine-1,2-dicarboxylate (PubChem CID 14751355) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl piperazine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl piperazine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 14751355 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1-O-benzyl 2-O-methyl piperazine-1,2-dicarboxylate |
| SMILES | COC(=O)C1CNCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H18N2O4/c1-19-13(17)12-9-15-7-8-16(12)14(18)20-10-11-5-3-2-4-6-11/h2-6,12,15H,7-10H2,1H3 |
| InChIKey | HOLPEQRNMJTIIX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |