C18H21N3O5 — CID 110798783
methyl 4-[3-(1,3-dioxoisoindol-2-yl)propanoyl]-1,4-diazepane-1-carboxylate (PubChem CID 110798783) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is methyl 4-[3-(1,3-dioxoisoindol-2-yl)propanoyl]-1,4-diazepane-1-carboxylate.
| Compound Name | methyl 4-[3-(1,3-dioxoisoindol-2-yl)propanoyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 110798783 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | methyl 4-[3-(1,3-dioxoisoindol-2-yl)propanoyl]-1,4-diazepane-1-carboxylate |
| SMILES | COC(=O)N1CCCN(C(=O)CCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C18H21N3O5/c1-26-18(25)20-9-4-8-19(11-12-20)15(22)7-10-21-16(23)13-5-2-3-6-14(13)17(21)24/h2-3,5-6H,4,7-12H2,1H3 |
| InChIKey | HYIZBBHCGBWWAU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|